C24H28N4O2 — CID 176501478
7-[(5-methoxy-3-methyl-1H-indol-2-yl)methyl]-2-(pyridin-2-ylmethyl)-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 176501478) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 7-[(5-methoxy-3-methyl-1H-indol-2-yl)methyl]-2-(pyridin-2-ylmethyl)-2,7-diazaspiro[4.4]nonan-1-one.
| Compound Name | 7-[(5-methoxy-3-methyl-1H-indol-2-yl)methyl]-2-(pyridin-2-ylmethyl)-2,7-diazaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 176501478 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 7-[(5-methoxy-3-methyl-1H-indol-2-yl)methyl]-2-(pyridin-2-ylmethyl)-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | COc1ccc2[nH]c(CN3CCC4(CCN(Cc5ccccn5)C4=O)C3)c(C)c2c1 |
| InChI | InChI=1S/C24H28N4O2/c1-17-20-13-19(30-2)6-7-21(20)26-22(17)15-27-11-8-24(16-27)9-12-28(23(24)29)14-18-5-3-4-10-25-18/h3-7,10,13,26H,8-9,11-12,14-16H2,1-2H3 |
| InChIKey | PMJTVYHSADEQEJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|