C26H28N4O2 — CID 175643597
2-(pyridin-2-ylmethyl)-7-(6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 175643597) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 2-(pyridin-2-ylmethyl)-7-(6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)-2,7-diazaspiro[4.4]nonan-1-one.
| Compound Name | 2-(pyridin-2-ylmethyl)-7-(6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)-2,7-diazaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 175643597 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 2-(pyridin-2-ylmethyl)-7-(6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | O=C(c1ccc2[nH]c3c(c2c1)CCCC3)N1CCC2(CCN(Cc3ccccn3)C2=O)C1 |
| InChI | InChI=1S/C26H28N4O2/c31-24(18-8-9-23-21(15-18)20-6-1-2-7-22(20)28-23)30-14-11-26(17-30)10-13-29(25(26)32)16-19-5-3-4-12-27-19/h3-5,8-9,12,15,28H,1-2,6-7,10-11,13-14,16-17H2 |
| InChIKey | BAJKADKEOOSIRN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|