C20H31ClN2O2 — CID 25454792
(3R,4R)-4-(azepan-1-yl)-1-[(3-chloro-4-ethoxyphenyl)methyl]piperidin-3-ol (PubChem CID 25454792) has the molecular formula C20H31ClN2O2 and a molecular weight of 366.93 g/mol. Its IUPAC name is (3R,4R)-4-(azepan-1-yl)-1-[(3-chloro-4-ethoxyphenyl)methyl]piperidin-3-ol.
| Compound Name | (3R,4R)-4-(azepan-1-yl)-1-[(3-chloro-4-ethoxyphenyl)methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 25454792 |
| Molecular Formula | C20H31ClN2O2 |
| Molecular Weight | 366.93 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (3R,4R)-4-(azepan-1-yl)-1-[(3-chloro-4-ethoxyphenyl)methyl]piperidin-3-ol |
| SMILES | CCOc1ccc(CN2CC[C@@H](N3CCCCCC3)[C@H](O)C2)cc1Cl |
| InChI | InChI=1S/C20H31ClN2O2/c1-2-25-20-8-7-16(13-17(20)21)14-22-12-9-18(19(24)15-22)23-10-5-3-4-6-11-23/h7-8,13,18-19,24H,2-6,9-12,14-15H2,1H3/t18-,19-/m1/s1 |
| InChIKey | MABMETUFHHVSIN-RTBURBONSA-N |
| XLogP | 3.55 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.93 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |