C18H27ClN2O — CID 77095203
1-[1-[(3-chloro-4-ethoxyphenyl)methyl]pyrrolidin-3-yl]piperidine (PubChem CID 77095203) has the molecular formula C18H27ClN2O and a molecular weight of 322.88 g/mol. Its IUPAC name is 1-[1-[(3-chloro-4-ethoxyphenyl)methyl]pyrrolidin-3-yl]piperidine.
| Compound Name | 1-[1-[(3-chloro-4-ethoxyphenyl)methyl]pyrrolidin-3-yl]piperidine |
|---|---|
| PubChem CID | 77095203 |
| Molecular Formula | C18H27ClN2O |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 1-[1-[(3-chloro-4-ethoxyphenyl)methyl]pyrrolidin-3-yl]piperidine |
| SMILES | CCOc1ccc(CN2CCC(N3CCCCC3)C2)cc1Cl |
| InChI | InChI=1S/C18H27ClN2O/c1-2-22-18-7-6-15(12-17(18)19)13-20-11-8-16(14-20)21-9-4-3-5-10-21/h6-7,12,16H,2-5,8-11,13-14H2,1H3 |
| InChIKey | WJHWMPIEJMYESD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |