C20H29N3 — CID 99938175
1-ethyl-5-[[(3R)-3-piperidin-1-ylpyrrolidin-1-yl]methyl]indole (PubChem CID 99938175) has the molecular formula C20H29N3 and a molecular weight of 311.47 g/mol. Its IUPAC name is 1-ethyl-5-[[(3R)-3-piperidin-1-ylpyrrolidin-1-yl]methyl]indole.
| Compound Name | 1-ethyl-5-[[(3R)-3-piperidin-1-ylpyrrolidin-1-yl]methyl]indole |
|---|---|
| PubChem CID | 99938175 |
| Molecular Formula | C20H29N3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | 1-ethyl-5-[[(3R)-3-piperidin-1-ylpyrrolidin-1-yl]methyl]indole |
| SMILES | CCn1ccc2cc(CN3CC[C@@H](N4CCCCC4)C3)ccc21 |
| InChI | InChI=1S/C20H29N3/c1-2-22-13-8-18-14-17(6-7-20(18)22)15-21-12-9-19(16-21)23-10-4-3-5-11-23/h6-8,13-14,19H,2-5,9-12,15-16H2,1H3/t19-/m1/s1 |
| InChIKey | BDDJRXQZDZGRGQ-LJQANCHMSA-N |
| XLogP | 3.72 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |