C17H21F3N2O — CID 162633591
1-ethyl-5-[[4-(trifluoromethoxy)piperidin-1-yl]methyl]indole (PubChem CID 162633591) has the molecular formula C17H21F3N2O and a molecular weight of 326.36 g/mol. Its IUPAC name is 1-ethyl-5-[[4-(trifluoromethoxy)piperidin-1-yl]methyl]indole.
| Compound Name | 1-ethyl-5-[[4-(trifluoromethoxy)piperidin-1-yl]methyl]indole |
|---|---|
| PubChem CID | 162633591 |
| Molecular Formula | C17H21F3N2O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 1-ethyl-5-[[4-(trifluoromethoxy)piperidin-1-yl]methyl]indole |
| SMILES | CCn1ccc2cc(CN3CCC(OC(F)(F)F)CC3)ccc21 |
| InChI | InChI=1S/C17H21F3N2O/c1-2-22-10-5-14-11-13(3-4-16(14)22)12-21-8-6-15(7-9-21)23-17(18,19)20/h3-5,10-11,15H,2,6-9,12H2,1H3 |
| InChIKey | UMOYXHSPNXINMB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |