C16H24N2O — CID 67310310
(3R,4R)-1-benzyl-4-pyrrolidin-1-ylpiperidin-3-ol (PubChem CID 67310310) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-4-pyrrolidin-1-ylpiperidin-3-ol.
| Compound Name | (3R,4R)-1-benzyl-4-pyrrolidin-1-ylpiperidin-3-ol |
|---|---|
| PubChem CID | 67310310 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | (3R,4R)-1-benzyl-4-pyrrolidin-1-ylpiperidin-3-ol |
| SMILES | O[C@@H]1CN(Cc2ccccc2)CC[C@H]1N1CCCC1 |
| InChI | InChI=1S/C16H24N2O/c19-16-13-17(12-14-6-2-1-3-7-14)11-8-15(16)18-9-4-5-10-18/h1-3,6-7,15-16,19H,4-5,8-13H2/t15-,16-/m1/s1 |
| InChIKey | ADIZCIWMWQICPG-HZPDHXFCSA-N |
| XLogP | 1.72 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |