C19H30N2 — CID 134324909
1-benzyl-3-ethyl-4-piperidin-1-ylpiperidine (PubChem CID 134324909) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 1-benzyl-3-ethyl-4-piperidin-1-ylpiperidine.
| Compound Name | 1-benzyl-3-ethyl-4-piperidin-1-ylpiperidine |
|---|---|
| PubChem CID | 134324909 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 1-benzyl-3-ethyl-4-piperidin-1-ylpiperidine |
| SMILES | CCC1CN(Cc2ccccc2)CCC1N1CCCCC1 |
| InChI | InChI=1S/C19H30N2/c1-2-18-16-20(15-17-9-5-3-6-10-17)14-11-19(18)21-12-7-4-8-13-21/h3,5-6,9-10,18-19H,2,4,7-8,11-16H2,1H3 |
| InChIKey | MDPRFDCJOUTULK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |