C24H37ClN4O — CID 51902775
2-[(2R)-4-[(7-chloro-3-methyl-1H-indol-2-yl)methyl]-1-(1-propan-2-ylpiperidin-4-yl)piperazin-2-yl]ethanol (PubChem CID 51902775) has the molecular formula C24H37ClN4O and a molecular weight of 433.04 g/mol. Its IUPAC name is 2-[(2R)-4-[(7-chloro-3-methyl-1H-indol-2-yl)methyl]-1-(1-propan-2-ylpiperidin-4-yl)piperazin-2-yl]ethanol.
| Compound Name | 2-[(2R)-4-[(7-chloro-3-methyl-1H-indol-2-yl)methyl]-1-(1-propan-2-ylpiperidin-4-yl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 51902775 |
| Molecular Formula | C24H37ClN4O |
| Molecular Weight | 433.04 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | 2-[(2R)-4-[(7-chloro-3-methyl-1H-indol-2-yl)methyl]-1-(1-propan-2-ylpiperidin-4-yl)piperazin-2-yl]ethanol |
| SMILES | Cc1c(CN2CCN(C3CCN(C(C)C)CC3)[C@H](CCO)C2)[nH]c2c(Cl)cccc12 |
| InChI | InChI=1S/C24H37ClN4O/c1-17(2)28-10-7-19(8-11-28)29-13-12-27(15-20(29)9-14-30)16-23-18(3)21-5-4-6-22(25)24(21)26-23/h4-6,17,19-20,26,30H,7-16H2,1-3H3/t20-/m1/s1 |
| InChIKey | XMYCBSSSVCUQTD-HXUWFJFHSA-N |
| XLogP | 3.87 |
| TPSA | 45.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.04 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|