C22H33N3O — CID 29088934
2-[(2S)-1-cyclopentyl-4-[(3,5-dimethyl-1H-indol-2-yl)methyl]piperazin-2-yl]ethanol (PubChem CID 29088934) has the molecular formula C22H33N3O and a molecular weight of 355.53 g/mol. Its IUPAC name is 2-[(2S)-1-cyclopentyl-4-[(3,5-dimethyl-1H-indol-2-yl)methyl]piperazin-2-yl]ethanol.
| Compound Name | 2-[(2S)-1-cyclopentyl-4-[(3,5-dimethyl-1H-indol-2-yl)methyl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 29088934 |
| Molecular Formula | C22H33N3O |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | 2-[(2S)-1-cyclopentyl-4-[(3,5-dimethyl-1H-indol-2-yl)methyl]piperazin-2-yl]ethanol |
| SMILES | Cc1ccc2[nH]c(CN3CCN(C4CCCC4)[C@@H](CCO)C3)c(C)c2c1 |
| InChI | InChI=1S/C22H33N3O/c1-16-7-8-21-20(13-16)17(2)22(23-21)15-24-10-11-25(18-5-3-4-6-18)19(14-24)9-12-26/h7-8,13,18-19,23,26H,3-6,9-12,14-15H2,1-2H3/t19-/m0/s1 |
| InChIKey | AUUGSVIAKVYGSJ-IBGZPJMESA-N |
| XLogP | 3.60 |
| TPSA | 42.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|