C23H39N3O — CID 45186472
2-[4-[(4-ethylphenyl)methyl]-1-(1-propan-2-ylpiperidin-4-yl)piperazin-2-yl]ethanol (PubChem CID 45186472) has the molecular formula C23H39N3O and a molecular weight of 373.59 g/mol. Its IUPAC name is 2-[4-[(4-ethylphenyl)methyl]-1-(1-propan-2-ylpiperidin-4-yl)piperazin-2-yl]ethanol.
| Compound Name | 2-[4-[(4-ethylphenyl)methyl]-1-(1-propan-2-ylpiperidin-4-yl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 45186472 |
| Molecular Formula | C23H39N3O |
| Molecular Weight | 373.59 g/mol |
| Exact Mass | 373.31 |
| IUPAC Name | 2-[4-[(4-ethylphenyl)methyl]-1-(1-propan-2-ylpiperidin-4-yl)piperazin-2-yl]ethanol |
| SMILES | CCc1ccc(CN2CCN(C3CCN(C(C)C)CC3)C(CCO)C2)cc1 |
| InChI | InChI=1S/C23H39N3O/c1-4-20-5-7-21(8-6-20)17-24-14-15-26(23(18-24)11-16-27)22-9-12-25(13-10-22)19(2)3/h5-8,19,22-23,27H,4,9-18H2,1-3H3 |
| InChIKey | MSOSKTIEKGGDTN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |