C21H34FN3O — CID 45171701
2-[4-[(2-fluorophenyl)methyl]-1-(1-propan-2-ylpiperidin-4-yl)piperazin-2-yl]ethanol (PubChem CID 45171701) has the molecular formula C21H34FN3O and a molecular weight of 363.52 g/mol. Its IUPAC name is 2-[4-[(2-fluorophenyl)methyl]-1-(1-propan-2-ylpiperidin-4-yl)piperazin-2-yl]ethanol.
| Compound Name | 2-[4-[(2-fluorophenyl)methyl]-1-(1-propan-2-ylpiperidin-4-yl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 45171701 |
| Molecular Formula | C21H34FN3O |
| Molecular Weight | 363.52 g/mol |
| Exact Mass | 363.27 |
| IUPAC Name | 2-[4-[(2-fluorophenyl)methyl]-1-(1-propan-2-ylpiperidin-4-yl)piperazin-2-yl]ethanol |
| SMILES | CC(C)N1CCC(N2CCN(Cc3ccccc3F)CC2CCO)CC1 |
| InChI | InChI=1S/C21H34FN3O/c1-17(2)24-10-7-19(8-11-24)25-13-12-23(16-20(25)9-14-26)15-18-5-3-4-6-21(18)22/h3-6,17,19-20,26H,7-16H2,1-2H3 |
| InChIKey | LOOULQCUALJHIS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.52 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |