C19H29FN2O2 — CID 26317541
(3R,4R)-4-(azepan-1-yl)-1-[(2-fluoro-4-methoxyphenyl)methyl]piperidin-3-ol (PubChem CID 26317541) has the molecular formula C19H29FN2O2 and a molecular weight of 336.45 g/mol. Its IUPAC name is (3R,4R)-4-(azepan-1-yl)-1-[(2-fluoro-4-methoxyphenyl)methyl]piperidin-3-ol.
| Compound Name | (3R,4R)-4-(azepan-1-yl)-1-[(2-fluoro-4-methoxyphenyl)methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 26317541 |
| Molecular Formula | C19H29FN2O2 |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (3R,4R)-4-(azepan-1-yl)-1-[(2-fluoro-4-methoxyphenyl)methyl]piperidin-3-ol |
| SMILES | COc1ccc(CN2CC[C@@H](N3CCCCCC3)[C@H](O)C2)c(F)c1 |
| InChI | InChI=1S/C19H29FN2O2/c1-24-16-7-6-15(17(20)12-16)13-21-11-8-18(19(23)14-21)22-9-4-2-3-5-10-22/h6-7,12,18-19,23H,2-5,8-11,13-14H2,1H3/t18-,19-/m1/s1 |
| InChIKey | WIYHIKZPDUAUDW-RTBURBONSA-N |
| XLogP | 2.65 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |