C15H22FNO2 — CID 77089960
4-ethoxy-1-[(2-fluoro-4-methoxyphenyl)methyl]piperidine (PubChem CID 77089960) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is 4-ethoxy-1-[(2-fluoro-4-methoxyphenyl)methyl]piperidine.
| Compound Name | 4-ethoxy-1-[(2-fluoro-4-methoxyphenyl)methyl]piperidine |
|---|---|
| PubChem CID | 77089960 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4-ethoxy-1-[(2-fluoro-4-methoxyphenyl)methyl]piperidine |
| SMILES | CCOC1CCN(Cc2ccc(OC)cc2F)CC1 |
| InChI | InChI=1S/C15H22FNO2/c1-3-19-13-6-8-17(9-7-13)11-12-4-5-14(18-2)10-15(12)16/h4-5,10,13H,3,6-9,11H2,1-2H3 |
| InChIKey | WHWNJGOCNVLSNY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |