C14H18FNO3 — CID 102878542
methyl 1-[(2-fluoro-4-methoxyphenyl)methyl]pyrrolidine-3-carboxylate (PubChem CID 102878542) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is methyl 1-[(2-fluoro-4-methoxyphenyl)methyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl 1-[(2-fluoro-4-methoxyphenyl)methyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 102878542 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | methyl 1-[(2-fluoro-4-methoxyphenyl)methyl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CCN(Cc2ccc(OC)cc2F)C1 |
| InChI | InChI=1S/C14H18FNO3/c1-18-12-4-3-10(13(15)7-12)8-16-6-5-11(9-16)14(17)19-2/h3-4,7,11H,5-6,8-9H2,1-2H3 |
| InChIKey | DCICCKXHRNSCCT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |