C18H27NO5 — CID 166834263
(3S,5R)-1-[2-[4-(oxan-4-yloxy)phenyl]ethyl]piperidine-3,4,5-triol (PubChem CID 166834263) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is (3S,5R)-1-[2-[4-(oxan-4-yloxy)phenyl]ethyl]piperidine-3,4,5-triol.
| Compound Name | (3S,5R)-1-[2-[4-(oxan-4-yloxy)phenyl]ethyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 166834263 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (3S,5R)-1-[2-[4-(oxan-4-yloxy)phenyl]ethyl]piperidine-3,4,5-triol |
| SMILES | OC1[C@H](O)CN(CCc2ccc(OC3CCOCC3)cc2)C[C@@H]1O |
| InChI | InChI=1S/C18H27NO5/c20-16-11-19(12-17(21)18(16)22)8-5-13-1-3-14(4-2-13)24-15-6-9-23-10-7-15/h1-4,15-18,20-22H,5-12H2/t16-,17+,18? |
| InChIKey | MNSDOIPEJWOUDV-JWTNVVGKSA-N |
| XLogP | 0.19 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |