About 4-(4-benzylphenoxy)oxane
4-(4-benzylphenoxy)oxane (PubChem CID 142700383) has the molecular formula C18H20O2
and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-(4-benzylphenoxy)oxane.
Molecular Properties
| Compound Name | 4-(4-benzylphenoxy)oxane |
| PubChem CID | 142700383 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 4-(4-benzylphenoxy)oxane |
| SMILES | c1ccc(Cc2ccc(OC3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C18H20O2/c1-2-4-15(5-3-1)14-16-6-8-17(9-7-16)20-18-10-12-19-13-11-18/h1-9,18H,10-14H2 |
| InChIKey | LAKIXPUHMKDIOI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-benzylphenoxy)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-benzylphenoxy)oxane?
The IUPAC name of 4-(4-benzylphenoxy)oxane (CID 142700383) is 4-(4-benzylphenoxy)oxane.
What is the SMILES notation for 4-(4-benzylphenoxy)oxane?
The canonical SMILES for 4-(4-benzylphenoxy)oxane is c1ccc(Cc2ccc(OC3CCOCC3)cc2)cc1.
What is the InChIKey of 4-(4-benzylphenoxy)oxane?
The InChIKey is LAKIXPUHMKDIOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O2/c1-2-4-15(5-3-1)14-16-6-8-17(9-7-16)20-18-10-12-19-13-11-18/h1-9,18H,10-14H2.
What are the key properties of 4-(4-benzylphenoxy)oxane?
4-(4-benzylphenoxy)oxane has a molecular weight of 268.36 g/mol, XLogP of 3.84, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-benzylphenoxy)oxane is sourced from PubChem (CID 142700383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).