C25H37FN2O5S — CID 56958975
tert-butyl (3aR,6aS)-5-[2-fluoro-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenoxy]-1,2,3,3a,4,5,6,6a-octahydropentalene-2-carboxylate (PubChem CID 56958975) has the molecular formula C25H37FN2O5S and a molecular weight of 496.65 g/mol. Its IUPAC name is tert-butyl (3aR,6aS)-5-[2-fluoro-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenoxy]-1,2,3,3a,4,5,6,6a-octahydropentalene-2-carboxylate.
| Compound Name | tert-butyl (3aR,6aS)-5-[2-fluoro-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenoxy]-1,2,3,3a,4,5,6,6a-octahydropentalene-2-carboxylate |
|---|---|
| PubChem CID | 56958975 |
| Molecular Formula | C25H37FN2O5S |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | tert-butyl (3aR,6aS)-5-[2-fluoro-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenoxy]-1,2,3,3a,4,5,6,6a-octahydropentalene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1C[C@H]2CC(Oc3ccc(CN4CCN(S(C)(=O)=O)CC4)cc3F)C[C@H]2C1 |
| InChI | InChI=1S/C25H37FN2O5S/c1-25(2,3)33-24(29)20-12-18-14-21(15-19(18)13-20)32-23-6-5-17(11-22(23)26)16-27-7-9-28(10-8-27)34(4,30)31/h5-6,11,18-21H,7-10,12-16H2,1-4H3/t18-,19+,20?,21? |
| InChIKey | JSJKQVBZQFGNMB-WHSGIHJSSA-N |
| XLogP | 3.43 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |