C16H24FN3O4S — CID 51335547
4-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]sulfonylmorpholine (PubChem CID 51335547) has the molecular formula C16H24FN3O4S and a molecular weight of 373.45 g/mol. Its IUPAC name is 4-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]sulfonylmorpholine.
| Compound Name | 4-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]sulfonylmorpholine |
|---|---|
| PubChem CID | 51335547 |
| Molecular Formula | C16H24FN3O4S |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 4-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]sulfonylmorpholine |
| SMILES | COc1ccc(CN2CCN(S(=O)(=O)N3CCOCC3)CC2)cc1F |
| InChI | InChI=1S/C16H24FN3O4S/c1-23-16-3-2-14(12-15(16)17)13-18-4-6-19(7-5-18)25(21,22)20-8-10-24-11-9-20/h2-3,12H,4-11,13H2,1H3 |
| InChIKey | NDVBBTBSSPNMGE-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |