C20H25FN2O3S — CID 33071081
1-[2-(benzenesulfonyl)ethyl]-4-[(3-fluoro-4-methoxyphenyl)methyl]piperazine (PubChem CID 33071081) has the molecular formula C20H25FN2O3S and a molecular weight of 392.50 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)ethyl]-4-[(3-fluoro-4-methoxyphenyl)methyl]piperazine.
| Compound Name | 1-[2-(benzenesulfonyl)ethyl]-4-[(3-fluoro-4-methoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 33071081 |
| Molecular Formula | C20H25FN2O3S |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-[2-(benzenesulfonyl)ethyl]-4-[(3-fluoro-4-methoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(CN2CCN(CCS(=O)(=O)c3ccccc3)CC2)cc1F |
| InChI | InChI=1S/C20H25FN2O3S/c1-26-20-8-7-17(15-19(20)21)16-23-11-9-22(10-12-23)13-14-27(24,25)18-5-3-2-4-6-18/h2-8,15H,9-14,16H2,1H3 |
| InChIKey | FNPVVBOYQCWVKP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |