C24H37BrN3O3S+ — CID 163419022
[4-[[4-[[(3aR)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]-3-bromophenyl]methyl]piperazin-1-yl]-methylsulfanium (PubChem CID 163419022) has the molecular formula C24H37BrN3O3S+ and a molecular weight of 527.55 g/mol. Its IUPAC name is [4-[[4-[[(3aR)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]-3-bromophenyl]methyl]piperazin-1-yl]-methylsulfanium.
| Compound Name | [4-[[4-[[(3aR)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]-3-bromophenyl]methyl]piperazin-1-yl]-methylsulfanium |
|---|---|
| PubChem CID | 163419022 |
| Molecular Formula | C24H37BrN3O3S+ |
| Molecular Weight | 527.55 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | [4-[[4-[[(3aR)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]-3-bromophenyl]methyl]piperazin-1-yl]-methylsulfanium |
| SMILES | C[SH+]N1CCN(Cc2ccc(OC3CC4CN(C(=O)OC(C)(C)C)C[C@@H]4C3)c(Br)c2)CC1 |
| InChI | InChI=1S/C24H36BrN3O3S/c1-24(2,3)31-23(29)27-15-18-12-20(13-19(18)16-27)30-22-6-5-17(11-21(22)25)14-26-7-9-28(32-4)10-8-26/h5-6,11,18-20H,7-10,12-16H2,1-4H3/p+1/t18-,19?,20?/m0/s1 |
| InChIKey | AGWBUUHVMJSCRQ-HDYDNRTBSA-O |
| XLogP | 3.95 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|