C21H31N3O4 — CID 118695318
5-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]-2-pyrrolidin-1-ylbenzoic acid (PubChem CID 118695318) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is 5-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]-2-pyrrolidin-1-ylbenzoic acid.
| Compound Name | 5-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]-2-pyrrolidin-1-ylbenzoic acid |
|---|---|
| PubChem CID | 118695318 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 5-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]-2-pyrrolidin-1-ylbenzoic acid |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccc(N3CCCC3)c(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C21H31N3O4/c1-21(2,3)28-20(27)24-12-10-22(11-13-24)15-16-6-7-18(17(14-16)19(25)26)23-8-4-5-9-23/h6-7,14H,4-5,8-13,15H2,1-3H3,(H,25,26) |
| InChIKey | BZGBRXWWTHUNTB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|