C21H25F3N4O3 — CID 175893129
butyl 2-[6-(trifluoromethoxy)quinazolin-4-yl]-2,7-diazaspiro[3.5]nonane-7-carboxylate (PubChem CID 175893129) has the molecular formula C21H25F3N4O3 and a molecular weight of 438.45 g/mol. Its IUPAC name is butyl 2-[6-(trifluoromethoxy)quinazolin-4-yl]-2,7-diazaspiro[3.5]nonane-7-carboxylate.
| Compound Name | butyl 2-[6-(trifluoromethoxy)quinazolin-4-yl]-2,7-diazaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 175893129 |
| Molecular Formula | C21H25F3N4O3 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | butyl 2-[6-(trifluoromethoxy)quinazolin-4-yl]-2,7-diazaspiro[3.5]nonane-7-carboxylate |
| SMILES | CCCCOC(=O)N1CCC2(CC1)CN(c1ncnc3ccc(OC(F)(F)F)cc13)C2 |
| InChI | InChI=1S/C21H25F3N4O3/c1-2-3-10-30-19(29)27-8-6-20(7-9-27)12-28(13-20)18-16-11-15(31-21(22,23)24)4-5-17(16)25-14-26-18/h4-5,11,14H,2-3,6-10,12-13H2,1H3 |
| InChIKey | MZYCFBLZXQSXOH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|