C17H21F4NO3 — CID 142687952
butyl 4-[2-fluoro-3-(trifluoromethyl)phenyl]-4-hydroxypiperidine-1-carboxylate (PubChem CID 142687952) has the molecular formula C17H21F4NO3 and a molecular weight of 363.35 g/mol. Its IUPAC name is butyl 4-[2-fluoro-3-(trifluoromethyl)phenyl]-4-hydroxypiperidine-1-carboxylate.
| Compound Name | butyl 4-[2-fluoro-3-(trifluoromethyl)phenyl]-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 142687952 |
| Molecular Formula | C17H21F4NO3 |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | butyl 4-[2-fluoro-3-(trifluoromethyl)phenyl]-4-hydroxypiperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(O)(c2cccc(C(F)(F)F)c2F)CC1 |
| InChI | InChI=1S/C17H21F4NO3/c1-2-3-11-25-15(23)22-9-7-16(24,8-10-22)12-5-4-6-13(14(12)18)17(19,20)21/h4-6,24H,2-3,7-11H2,1H3 |
| InChIKey | MWKXUYGGRSODCR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|