C24H28N2O3 — CID 144930300
butyl 1-benzyl-2-oxospiro[indole-3,4'-piperidine]-1'-carboxylate (PubChem CID 144930300) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is butyl 1-benzyl-2-oxospiro[indole-3,4'-piperidine]-1'-carboxylate.
| Compound Name | butyl 1-benzyl-2-oxospiro[indole-3,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 144930300 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | butyl 1-benzyl-2-oxospiro[indole-3,4'-piperidine]-1'-carboxylate |
| SMILES | CCCCOC(=O)N1CCC2(CC1)C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C24H28N2O3/c1-2-3-17-29-23(28)25-15-13-24(14-16-25)20-11-7-8-12-21(20)26(22(24)27)18-19-9-5-4-6-10-19/h4-12H,2-3,13-18H2,1H3 |
| InChIKey | WVAXVUPSZLSXSB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|