C23H32N2O6 — CID 134786315
8-O-butyl 4-O-ethyl (3R,4R)-1-benzyl-3-hydroxy-2-oxo-1,8-diazaspiro[4.5]decane-4,8-dicarboxylate (PubChem CID 134786315) has the molecular formula C23H32N2O6 and a molecular weight of 432.52 g/mol. Its IUPAC name is 8-O-butyl 4-O-ethyl (3R,4R)-1-benzyl-3-hydroxy-2-oxo-1,8-diazaspiro[4.5]decane-4,8-dicarboxylate.
| Compound Name | 8-O-butyl 4-O-ethyl (3R,4R)-1-benzyl-3-hydroxy-2-oxo-1,8-diazaspiro[4.5]decane-4,8-dicarboxylate |
|---|---|
| PubChem CID | 134786315 |
| Molecular Formula | C23H32N2O6 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 8-O-butyl 4-O-ethyl (3R,4R)-1-benzyl-3-hydroxy-2-oxo-1,8-diazaspiro[4.5]decane-4,8-dicarboxylate |
| SMILES | CCCCOC(=O)N1CCC2(CC1)[C@@H](C(=O)OCC)[C@@H](O)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C23H32N2O6/c1-3-5-15-31-22(29)24-13-11-23(12-14-24)18(21(28)30-4-2)19(26)20(27)25(23)16-17-9-7-6-8-10-17/h6-10,18-19,26H,3-5,11-16H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | LCXVQJRHKXDFKH-RTBURBONSA-N |
| XLogP | 2.34 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|