C16H17F3N4O — CID 175930530
4-(2,7-diazaspiro[3.5]nonan-7-yl)-6-(trifluoromethoxy)quinazoline (PubChem CID 175930530) has the molecular formula C16H17F3N4O and a molecular weight of 338.33 g/mol. Its IUPAC name is 4-(2,7-diazaspiro[3.5]nonan-7-yl)-6-(trifluoromethoxy)quinazoline.
| Compound Name | 4-(2,7-diazaspiro[3.5]nonan-7-yl)-6-(trifluoromethoxy)quinazoline |
|---|---|
| PubChem CID | 175930530 |
| Molecular Formula | C16H17F3N4O |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 4-(2,7-diazaspiro[3.5]nonan-7-yl)-6-(trifluoromethoxy)quinazoline |
| SMILES | FC(F)(F)Oc1ccc2ncnc(N3CCC4(CC3)CNC4)c2c1 |
| InChI | InChI=1S/C16H17F3N4O/c17-16(18,19)24-11-1-2-13-12(7-11)14(22-10-21-13)23-5-3-15(4-6-23)8-20-9-15/h1-2,7,10,20H,3-6,8-9H2 |
| InChIKey | UWBISMWHNPPCDF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |