C12H13F3N2O — CID 135192815
2-[4-(trifluoromethoxy)phenyl]-2,6-diazaspiro[3.3]heptane (PubChem CID 135192815) has the molecular formula C12H13F3N2O and a molecular weight of 258.24 g/mol. Its IUPAC name is 2-[4-(trifluoromethoxy)phenyl]-2,6-diazaspiro[3.3]heptane.
| Compound Name | 2-[4-(trifluoromethoxy)phenyl]-2,6-diazaspiro[3.3]heptane |
|---|---|
| PubChem CID | 135192815 |
| Molecular Formula | C12H13F3N2O |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2-[4-(trifluoromethoxy)phenyl]-2,6-diazaspiro[3.3]heptane |
| SMILES | FC(F)(F)Oc1ccc(N2CC3(CNC3)C2)cc1 |
| InChI | InChI=1S/C12H13F3N2O/c13-12(14,15)18-10-3-1-9(2-4-10)17-7-11(8-17)5-16-6-11/h1-4,16H,5-8H2 |
| InChIKey | MSJWGOJMZFDRFY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|