C15H19F3N2O — CID 162686588
3-[1-[4-(trifluoromethoxy)phenyl]azetidin-3-yl]piperidine (PubChem CID 162686588) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is 3-[1-[4-(trifluoromethoxy)phenyl]azetidin-3-yl]piperidine.
| Compound Name | 3-[1-[4-(trifluoromethoxy)phenyl]azetidin-3-yl]piperidine |
|---|---|
| PubChem CID | 162686588 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3-[1-[4-(trifluoromethoxy)phenyl]azetidin-3-yl]piperidine |
| SMILES | FC(F)(F)Oc1ccc(N2CC(C3CCCNC3)C2)cc1 |
| InChI | InChI=1S/C15H19F3N2O/c16-15(17,18)21-14-5-3-13(4-6-14)20-9-12(10-20)11-2-1-7-19-8-11/h3-6,11-12,19H,1-2,7-10H2 |
| InChIKey | IVBCRKLZSSPRMX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|