C20H29BrN2O4 — CID 168992404
methyl 2-(bromomethyl)-4-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]piperidin-1-yl]benzoate (PubChem CID 168992404) has the molecular formula C20H29BrN2O4 and a molecular weight of 441.37 g/mol. Its IUPAC name is methyl 2-(bromomethyl)-4-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]piperidin-1-yl]benzoate.
| Compound Name | methyl 2-(bromomethyl)-4-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]piperidin-1-yl]benzoate |
|---|---|
| PubChem CID | 168992404 |
| Molecular Formula | C20H29BrN2O4 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | methyl 2-(bromomethyl)-4-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]piperidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CCC(N(C)C(=O)OC(C)(C)C)CC2)cc1CBr |
| InChI | InChI=1S/C20H29BrN2O4/c1-20(2,3)27-19(25)22(4)15-8-10-23(11-9-15)16-6-7-17(18(24)26-5)14(12-16)13-21/h6-7,12,15H,8-11,13H2,1-5H3 |
| InChIKey | WDKUSKQUPGTMPB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|