C23H34N4O4 — CID 170624579
tert-butyl N-[1-[3-[[(3R)-2,6-dioxopiperidin-3-yl]-methylamino]phenyl]piperidin-4-yl]-N-methylcarbamate (PubChem CID 170624579) has the molecular formula C23H34N4O4 and a molecular weight of 430.55 g/mol. Its IUPAC name is tert-butyl N-[1-[3-[[(3R)-2,6-dioxopiperidin-3-yl]-methylamino]phenyl]piperidin-4-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-[3-[[(3R)-2,6-dioxopiperidin-3-yl]-methylamino]phenyl]piperidin-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 170624579 |
| Molecular Formula | C23H34N4O4 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | tert-butyl N-[1-[3-[[(3R)-2,6-dioxopiperidin-3-yl]-methylamino]phenyl]piperidin-4-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCN(c2cccc(N(C)[C@@H]3CCC(=O)NC3=O)c2)CC1 |
| InChI | InChI=1S/C23H34N4O4/c1-23(2,3)31-22(30)26(5)16-11-13-27(14-12-16)18-8-6-7-17(15-18)25(4)19-9-10-20(28)24-21(19)29/h6-8,15-16,19H,9-14H2,1-5H3,(H,24,28,29)/t19-/m1/s1 |
| InChIKey | DCGBHTOJVWPLJT-LJQANCHMSA-N |
| XLogP | 2.76 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|