C18H29N3O3 — CID 142621549
tert-butyl N-[1-(4-amino-2-methoxyphenyl)piperidin-4-yl]-N-methylcarbamate (PubChem CID 142621549) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is tert-butyl N-[1-(4-amino-2-methoxyphenyl)piperidin-4-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-(4-amino-2-methoxyphenyl)piperidin-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 142621549 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | tert-butyl N-[1-(4-amino-2-methoxyphenyl)piperidin-4-yl]-N-methylcarbamate |
| SMILES | COc1cc(N)ccc1N1CCC(N(C)C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H29N3O3/c1-18(2,3)24-17(22)20(4)14-8-10-21(11-9-14)15-7-6-13(19)12-16(15)23-5/h6-7,12,14H,8-11,19H2,1-5H3 |
| InChIKey | OLXJRJPIOHMRHD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|