C11H16N2O3 — CID 58387717
(3R,4S)-1-(4-amino-2-methoxyphenyl)pyrrolidine-3,4-diol (PubChem CID 58387717) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is (3R,4S)-1-(4-amino-2-methoxyphenyl)pyrrolidine-3,4-diol.
| Compound Name | (3R,4S)-1-(4-amino-2-methoxyphenyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 58387717 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (3R,4S)-1-(4-amino-2-methoxyphenyl)pyrrolidine-3,4-diol |
| SMILES | COc1cc(N)ccc1N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C11H16N2O3/c1-16-11-4-7(12)2-3-8(11)13-5-9(14)10(15)6-13/h2-4,9-10,14-15H,5-6,12H2,1H3/t9-,10+ |
| InChIKey | GZDFKAZTZDRWKP-AOOOYVTPSA-N |
| XLogP | -0.18 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|