C16H24N2O3 — CID 163747615
[(3R)-1-(4-amino-2-methoxyphenyl)pyrrolidin-3-yl] 3-methylbutanoate (PubChem CID 163747615) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is [(3R)-1-(4-amino-2-methoxyphenyl)pyrrolidin-3-yl] 3-methylbutanoate.
| Compound Name | [(3R)-1-(4-amino-2-methoxyphenyl)pyrrolidin-3-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 163747615 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | [(3R)-1-(4-amino-2-methoxyphenyl)pyrrolidin-3-yl] 3-methylbutanoate |
| SMILES | COc1cc(N)ccc1N1CC[C@@H](OC(=O)CC(C)C)C1 |
| InChI | InChI=1S/C16H24N2O3/c1-11(2)8-16(19)21-13-6-7-18(10-13)14-5-4-12(17)9-15(14)20-3/h4-5,9,11,13H,6-8,10,17H2,1-3H3/t13-/m1/s1 |
| InChIKey | LNFHRNNORBPHSS-CYBMUJFWSA-N |
| XLogP | 2.45 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|