C16H25N3O3 — CID 118164469
butyl 4-(4-amino-2-methoxyphenyl)piperazine-1-carboxylate (PubChem CID 118164469) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is butyl 4-(4-amino-2-methoxyphenyl)piperazine-1-carboxylate.
| Compound Name | butyl 4-(4-amino-2-methoxyphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 118164469 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | butyl 4-(4-amino-2-methoxyphenyl)piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(c2ccc(N)cc2OC)CC1 |
| InChI | InChI=1S/C16H25N3O3/c1-3-4-11-22-16(20)19-9-7-18(8-10-19)14-6-5-13(17)12-15(14)21-2/h5-6,12H,3-4,7-11,17H2,1-2H3 |
| InChIKey | ZKPAFQQQDZTYCR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|