C20H29N5O5 — CID 134115334
butyl 4-(4-amino-6,7,8-trimethoxyquinazolin-2-yl)piperazine-1-carboxylate (PubChem CID 134115334) has the molecular formula C20H29N5O5 and a molecular weight of 419.48 g/mol. Its IUPAC name is butyl 4-(4-amino-6,7,8-trimethoxyquinazolin-2-yl)piperazine-1-carboxylate.
| Compound Name | butyl 4-(4-amino-6,7,8-trimethoxyquinazolin-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 134115334 |
| Molecular Formula | C20H29N5O5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | butyl 4-(4-amino-6,7,8-trimethoxyquinazolin-2-yl)piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(c2nc(N)c3cc(OC)c(OC)c(OC)c3n2)CC1 |
| InChI | InChI=1S/C20H29N5O5/c1-5-6-11-30-20(26)25-9-7-24(8-10-25)19-22-15-13(18(21)23-19)12-14(27-2)16(28-3)17(15)29-4/h12H,5-11H2,1-4H3,(H2,21,22,23) |
| InChIKey | CWHWIXJUJHAKCM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|