C17H23ClN2O4 — CID 108568498
butyl 4-(5-chloro-2-methoxybenzoyl)piperazine-1-carboxylate (PubChem CID 108568498) has the molecular formula C17H23ClN2O4 and a molecular weight of 354.83 g/mol. Its IUPAC name is butyl 4-(5-chloro-2-methoxybenzoyl)piperazine-1-carboxylate.
| Compound Name | butyl 4-(5-chloro-2-methoxybenzoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108568498 |
| Molecular Formula | C17H23ClN2O4 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | butyl 4-(5-chloro-2-methoxybenzoyl)piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(C(=O)c2cc(Cl)ccc2OC)CC1 |
| InChI | InChI=1S/C17H23ClN2O4/c1-3-4-11-24-17(22)20-9-7-19(8-10-20)16(21)14-12-13(18)5-6-15(14)23-2/h5-6,12H,3-4,7-11H2,1-2H3 |
| InChIKey | NOBLMOBKBRTQKL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|