C17H22Cl2N2O3 — CID 108568491
3-chloro-1-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 108568491) has the molecular formula C17H22Cl2N2O3 and a molecular weight of 373.28 g/mol. Its IUPAC name is 3-chloro-1-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 3-chloro-1-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 108568491 |
| Molecular Formula | C17H22Cl2N2O3 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 3-chloro-1-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCN(C(=O)C(C)(C)CCl)CC1 |
| InChI | InChI=1S/C17H22Cl2N2O3/c1-17(2,11-18)16(23)21-8-6-20(7-9-21)15(22)13-10-12(19)4-5-14(13)24-3/h4-5,10H,6-9,11H2,1-3H3 |
| InChIKey | BBZCQAVCCYIEJI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|