C21H22N4O5 — CID 157053560
1-(4-amino-2-methoxyphenyl)pyrrolidine-2,5-dione;1-(4-aminophenyl)pyrrolidine-2,5-dione (PubChem CID 157053560) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is 1-(4-amino-2-methoxyphenyl)pyrrolidine-2,5-dione;1-(4-aminophenyl)pyrrolidine-2,5-dione.
| Compound Name | 1-(4-amino-2-methoxyphenyl)pyrrolidine-2,5-dione;1-(4-aminophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 157053560 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 1-(4-amino-2-methoxyphenyl)pyrrolidine-2,5-dione;1-(4-aminophenyl)pyrrolidine-2,5-dione |
| SMILES | COc1cc(N)ccc1N1C(=O)CCC1=O.Nc1ccc(N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C11H12N2O3.C10H10N2O2/c1-16-9-6-7(12)2-3-8(9)13-10(14)4-5-11(13)15;11-7-1-3-8(4-2-7)12-9(13)5-6-10(12)14/h2-3,6H,4-5,12H2,1H3;1-4H,5-6,11H2 |
| InChIKey | AAMIBVOYXKETFY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 136.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|