C20H18Cl2N4O4 — CID 159530815
1-(4-amino-2,6-dichlorophenyl)pyrrolidine-2,5-dione;1-(4-aminophenyl)pyrrolidine-2,5-dione (PubChem CID 159530815) has the molecular formula C20H18Cl2N4O4 and a molecular weight of 449.29 g/mol. Its IUPAC name is 1-(4-amino-2,6-dichlorophenyl)pyrrolidine-2,5-dione;1-(4-aminophenyl)pyrrolidine-2,5-dione.
| Compound Name | 1-(4-amino-2,6-dichlorophenyl)pyrrolidine-2,5-dione;1-(4-aminophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 159530815 |
| Molecular Formula | C20H18Cl2N4O4 |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 1-(4-amino-2,6-dichlorophenyl)pyrrolidine-2,5-dione;1-(4-aminophenyl)pyrrolidine-2,5-dione |
| SMILES | Nc1cc(Cl)c(N2C(=O)CCC2=O)c(Cl)c1.Nc1ccc(N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C10H8Cl2N2O2.C10H10N2O2/c11-6-3-5(13)4-7(12)10(6)14-8(15)1-2-9(14)16;11-7-1-3-8(4-2-7)12-9(13)5-6-10(12)14/h3-4H,1-2,13H2;1-4H,5-6,11H2 |
| InChIKey | MCYVTZMDIYJKTP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|