C14H9Cl2N3O2 — CID 139787354
5-amino-2-(4-amino-2,6-dichlorophenyl)isoindole-1,3-dione (PubChem CID 139787354) has the molecular formula C14H9Cl2N3O2 and a molecular weight of 322.15 g/mol. Its IUPAC name is 5-amino-2-(4-amino-2,6-dichlorophenyl)isoindole-1,3-dione.
| Compound Name | 5-amino-2-(4-amino-2,6-dichlorophenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 139787354 |
| Molecular Formula | C14H9Cl2N3O2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 5-amino-2-(4-amino-2,6-dichlorophenyl)isoindole-1,3-dione |
| SMILES | Nc1cc(Cl)c(N2C(=O)c3ccc(N)cc3C2=O)c(Cl)c1 |
| InChI | InChI=1S/C14H9Cl2N3O2/c15-10-4-7(18)5-11(16)12(10)19-13(20)8-2-1-6(17)3-9(8)14(19)21/h1-5H,17-18H2 |
| InChIKey | ORZKISIVOSZHCM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|