C15H13N3O3 — CID 139787309
5-amino-2-(5-amino-2-methoxyphenyl)isoindole-1,3-dione (PubChem CID 139787309) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is 5-amino-2-(5-amino-2-methoxyphenyl)isoindole-1,3-dione.
| Compound Name | 5-amino-2-(5-amino-2-methoxyphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 139787309 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 5-amino-2-(5-amino-2-methoxyphenyl)isoindole-1,3-dione |
| SMILES | COc1ccc(N)cc1N1C(=O)c2ccc(N)cc2C1=O |
| InChI | InChI=1S/C15H13N3O3/c1-21-13-5-3-9(17)7-12(13)18-14(19)10-4-2-8(16)6-11(10)15(18)20/h2-7H,16-17H2,1H3 |
| InChIKey | SYFVMXUCTKTCKN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|