C36H26N4O6 — CID 171043375
5-(4-aminophenyl)-2-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-3,5-dimethoxyphenyl]isoindole-1,3-dione (PubChem CID 171043375) has the molecular formula C36H26N4O6 and a molecular weight of 610.63 g/mol. Its IUPAC name is 5-(4-aminophenyl)-2-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-3,5-dimethoxyphenyl]isoindole-1,3-dione.
| Compound Name | 5-(4-aminophenyl)-2-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-3,5-dimethoxyphenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171043375 |
| Molecular Formula | C36H26N4O6 |
| Molecular Weight | 610.63 g/mol |
| Exact Mass | 610.19 |
| IUPAC Name | 5-(4-aminophenyl)-2-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-3,5-dimethoxyphenyl]isoindole-1,3-dione |
| SMILES | COc1cc(N2C(=O)c3ccc(-c4ccc(N)cc4)cc3C2=O)cc(OC)c1N1C(=O)c2ccc(-c3ccc(N)cc3)cc2C1=O |
| InChI | InChI=1S/C36H26N4O6/c1-45-30-17-25(39-33(41)26-13-7-21(15-28(26)35(39)43)19-3-9-23(37)10-4-19)18-31(46-2)32(30)40-34(42)27-14-8-22(16-29(27)36(40)44)20-5-11-24(38)12-6-20/h3-18H,37-38H2,1-2H3 |
| InChIKey | IEKAAHRIHWWKLI-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 145.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.63 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|