C53H35N3O6 — CID 162769468
2-[4-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-3,5-diphenoxyphenyl]phenyl]-5-(4-methylphenyl)isoindole-1,3-dione (PubChem CID 162769468) has the molecular formula C53H35N3O6 and a molecular weight of 809.88 g/mol. Its IUPAC name is 2-[4-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-3,5-diphenoxyphenyl]phenyl]-5-(4-methylphenyl)isoindole-1,3-dione.
| Compound Name | 2-[4-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-3,5-diphenoxyphenyl]phenyl]-5-(4-methylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 162769468 |
| Molecular Formula | C53H35N3O6 |
| Molecular Weight | 809.88 g/mol |
| Exact Mass | 809.25 |
| IUPAC Name | 2-[4-[4-[5-(4-aminophenyl)-1,3-dioxoisoindol-2-yl]-3,5-diphenoxyphenyl]phenyl]-5-(4-methylphenyl)isoindole-1,3-dione |
| SMILES | Cc1ccc(-c2ccc3c(c2)C(=O)N(c2ccc(-c4cc(Oc5ccccc5)c(N5C(=O)c6ccc(-c7ccc(N)cc7)cc6C5=O)c(Oc5ccccc5)c4)cc2)C3=O)cc1 |
| InChI | InChI=1S/C53H35N3O6/c1-32-12-14-33(15-13-32)36-20-26-43-45(28-36)52(59)55(50(43)57)40-24-18-35(19-25-40)38-30-47(61-41-8-4-2-5-9-41)49(48(31-38)62-42-10-6-3-7-11-42)56-51(58)44-27-21-37(29-46(44)53(56)60)34-16-22-39(54)23-17-34/h2-31H,54H2,1H3 |
| InChIKey | MIVLOJLLEAKVNC-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.88 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|