C56H48N2O4 — CID 162769294
2-[4-[2,3-ditert-butyl-4-[4-[5-(4-methylphenyl)-1,3-dioxoisoindol-2-yl]phenyl]phenyl]phenyl]-5-(4-methylphenyl)isoindole-1,3-dione (PubChem CID 162769294) has the molecular formula C56H48N2O4 and a molecular weight of 813.01 g/mol. Its IUPAC name is 2-[4-[2,3-ditert-butyl-4-[4-[5-(4-methylphenyl)-1,3-dioxoisoindol-2-yl]phenyl]phenyl]phenyl]-5-(4-methylphenyl)isoindole-1,3-dione.
| Compound Name | 2-[4-[2,3-ditert-butyl-4-[4-[5-(4-methylphenyl)-1,3-dioxoisoindol-2-yl]phenyl]phenyl]phenyl]-5-(4-methylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 162769294 |
| Molecular Formula | C56H48N2O4 |
| Molecular Weight | 813.01 g/mol |
| Exact Mass | 812.36 |
| IUPAC Name | 2-[4-[2,3-ditert-butyl-4-[4-[5-(4-methylphenyl)-1,3-dioxoisoindol-2-yl]phenyl]phenyl]phenyl]-5-(4-methylphenyl)isoindole-1,3-dione |
| SMILES | Cc1ccc(-c2ccc3c(c2)C(=O)N(c2ccc(-c4ccc(-c5ccc(N6C(=O)c7ccc(-c8ccc(C)cc8)cc7C6=O)cc5)c(C(C)(C)C)c4C(C)(C)C)cc2)C3=O)cc1 |
| InChI | InChI=1S/C56H48N2O4/c1-33-9-13-35(14-10-33)39-21-27-45-47(31-39)53(61)57(51(45)59)41-23-17-37(18-24-41)43-29-30-44(50(56(6,7)8)49(43)55(3,4)5)38-19-25-42(26-20-38)58-52(60)46-28-22-40(32-48(46)54(58)62)36-15-11-34(2)12-16-36/h9-32H,1-8H3 |
| InChIKey | YECYSQQCAKEHLM-UHFFFAOYSA-N |
| XLogP | 13.17 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.01 |
| LogP ≤ 5 | 13.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|