C42H36N2O4 — CID 162769427
5-(4-methylphenyl)-2-[4-[5-(4-methylphenyl)-1,3-dioxoisoindol-2-yl]-2,3-di(propan-2-yl)phenyl]isoindole-1,3-dione (PubChem CID 162769427) has the molecular formula C42H36N2O4 and a molecular weight of 632.76 g/mol. Its IUPAC name is 5-(4-methylphenyl)-2-[4-[5-(4-methylphenyl)-1,3-dioxoisoindol-2-yl]-2,3-di(propan-2-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 5-(4-methylphenyl)-2-[4-[5-(4-methylphenyl)-1,3-dioxoisoindol-2-yl]-2,3-di(propan-2-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 162769427 |
| Molecular Formula | C42H36N2O4 |
| Molecular Weight | 632.76 g/mol |
| Exact Mass | 632.27 |
| IUPAC Name | 5-(4-methylphenyl)-2-[4-[5-(4-methylphenyl)-1,3-dioxoisoindol-2-yl]-2,3-di(propan-2-yl)phenyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(-c2ccc3c(c2)C(=O)N(c2ccc(N4C(=O)c5ccc(-c6ccc(C)cc6)cc5C4=O)c(C(C)C)c2C(C)C)C3=O)cc1 |
| InChI | InChI=1S/C42H36N2O4/c1-23(2)37-35(43-39(45)31-17-15-29(21-33(31)41(43)47)27-11-7-25(5)8-12-27)19-20-36(38(37)24(3)4)44-40(46)32-18-16-30(22-34(32)42(44)48)28-13-9-26(6)10-14-28/h7-24H,1-6H3 |
| InChIKey | XHGHHURUYIMPDD-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.76 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|