C48H40N2O4 — CID 162769432
5-(4-methylphenyl)-2-[2,3,5-trimethyl-4-[2,3,5-trimethyl-4-[5-(4-methylphenyl)-1,3-dioxoisoindol-2-yl]phenyl]phenyl]isoindole-1,3-dione (PubChem CID 162769432) has the molecular formula C48H40N2O4 and a molecular weight of 708.86 g/mol. Its IUPAC name is 5-(4-methylphenyl)-2-[2,3,5-trimethyl-4-[2,3,5-trimethyl-4-[5-(4-methylphenyl)-1,3-dioxoisoindol-2-yl]phenyl]phenyl]isoindole-1,3-dione.
| Compound Name | 5-(4-methylphenyl)-2-[2,3,5-trimethyl-4-[2,3,5-trimethyl-4-[5-(4-methylphenyl)-1,3-dioxoisoindol-2-yl]phenyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 162769432 |
| Molecular Formula | C48H40N2O4 |
| Molecular Weight | 708.86 g/mol |
| Exact Mass | 708.30 |
| IUPAC Name | 5-(4-methylphenyl)-2-[2,3,5-trimethyl-4-[2,3,5-trimethyl-4-[5-(4-methylphenyl)-1,3-dioxoisoindol-2-yl]phenyl]phenyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(-c2ccc3c(c2)C(=O)N(c2cc(C)c(-c4cc(C)c(N5C(=O)c6ccc(-c7ccc(C)cc7)cc6C5=O)c(C)c4C)c(C)c2C)C3=O)cc1 |
| InChI | InChI=1S/C48H40N2O4/c1-25-9-13-33(14-10-25)35-17-19-37-40(23-35)47(53)49(45(37)51)42-22-27(3)43(31(7)30(42)6)39-21-28(4)44(32(8)29(39)5)50-46(52)38-20-18-36(24-41(38)48(50)54)34-15-11-26(2)12-16-34/h9-24H,1-8H3 |
| InChIKey | CPYRRYMNGFOMAH-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.86 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|