C29H20F6N2O4 — CID 122608324
5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(2,3,4,6-tetramethylphenyl)isoindole-1,3-dione (PubChem CID 122608324) has the molecular formula C29H20F6N2O4 and a molecular weight of 574.48 g/mol. Its IUPAC name is 5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(2,3,4,6-tetramethylphenyl)isoindole-1,3-dione.
| Compound Name | 5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(2,3,4,6-tetramethylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 122608324 |
| Molecular Formula | C29H20F6N2O4 |
| Molecular Weight | 574.48 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | 5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(2,3,4,6-tetramethylphenyl)isoindole-1,3-dione |
| SMILES | Cc1cc(C)c(N2C(=O)c3ccc(C(c4ccc5c(c4)C(=O)NC5=O)(C(F)(F)F)C(F)(F)F)cc3C2=O)c(C)c1C |
| InChI | InChI=1S/C29H20F6N2O4/c1-12-9-13(2)22(15(4)14(12)3)37-25(40)19-8-6-17(11-21(19)26(37)41)27(28(30,31)32,29(33,34)35)16-5-7-18-20(10-16)24(39)36-23(18)38/h5-11H,1-4H3,(H,36,38,39) |
| InChIKey | PVRYJMMYOTYLIY-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.48 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|