C34H16F12N2O6 — CID 135291657
5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]-2-hydroxyphenyl]isoindole-1,3-dione (PubChem CID 135291657) has the molecular formula C34H16F12N2O6 and a molecular weight of 776.49 g/mol. Its IUPAC name is 5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]-2-hydroxyphenyl]isoindole-1,3-dione.
| Compound Name | 5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]-2-hydroxyphenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 135291657 |
| Molecular Formula | C34H16F12N2O6 |
| Molecular Weight | 776.49 g/mol |
| Exact Mass | 776.08 |
| IUPAC Name | 5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]-2-hydroxyphenyl]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(C(c3ccc4c(c3)C(=O)N(c3cc(C(c5ccc(O)cc5)(C(F)(F)F)C(F)(F)F)ccc3O)C4=O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C34H16F12N2O6/c35-31(36,37)29(32(38,39)40,14-1-6-18(49)7-2-14)17-5-10-24(50)23(13-17)48-27(53)20-9-4-16(12-22(20)28(48)54)30(33(41,42)43,34(44,45)46)15-3-8-19-21(11-15)26(52)47-25(19)51/h1-13,49-50H,(H,47,51,52) |
| InChIKey | WWVVIQNLPDXOOH-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.49 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|