C43H36F6N2O8 — CID 135264644
4-[3-[5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl]benzoyl]oxybutyl 3-tert-butyl-5-ethylbenzoate (PubChem CID 135264644) has the molecular formula C43H36F6N2O8 and a molecular weight of 822.75 g/mol. Its IUPAC name is 4-[3-[5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl]benzoyl]oxybutyl 3-tert-butyl-5-ethylbenzoate.
| Compound Name | 4-[3-[5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl]benzoyl]oxybutyl 3-tert-butyl-5-ethylbenzoate |
|---|---|
| PubChem CID | 135264644 |
| Molecular Formula | C43H36F6N2O8 |
| Molecular Weight | 822.75 g/mol |
| Exact Mass | 822.24 |
| IUPAC Name | 4-[3-[5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,3-dioxoisoindol-2-yl]benzoyl]oxybutyl 3-tert-butyl-5-ethylbenzoate |
| SMILES | CCc1cc(C(=O)OCCCCOC(=O)c2cccc(N3C(=O)c4ccc(C(c5ccc6c(c5)C(=O)NC6=O)(C(F)(F)F)C(F)(F)F)cc4C3=O)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C43H36F6N2O8/c1-5-23-17-25(19-28(18-23)40(2,3)4)39(57)59-16-7-6-15-58-38(56)24-9-8-10-29(20-24)51-36(54)31-14-12-27(22-33(31)37(51)55)41(42(44,45)46,43(47,48)49)26-11-13-30-32(21-26)35(53)50-34(30)52/h8-14,17-22H,5-7,15-16H2,1-4H3,(H,50,52,53) |
| InChIKey | JYTGNJZBJDOXHB-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.75 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|